C20H27F3N6O3 — CID 154616663
[(1R,3S)-3-[3-[[2-(1,5-dimethylpyrazol-4-yl)acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl] N-(4,4,4-trifluorobutan-2-yl)carbamate (PubChem CID 154616663) has the molecular formula C20H27F3N6O3 and a molecular weight of 456.47 g/mol. Its IUPAC name is [(1R,3S)-3-[3-[[2-(1,5-dimethylpyrazol-4-yl)acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl] N-(4,4,4-trifluorobutan-2-yl)carbamate.
| Compound Name | [(1R,3S)-3-[3-[[2-(1,5-dimethylpyrazol-4-yl)acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl] N-(4,4,4-trifluorobutan-2-yl)carbamate |
|---|---|
| PubChem CID | 154616663 |
| Molecular Formula | C20H27F3N6O3 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | [(1R,3S)-3-[3-[[2-(1,5-dimethylpyrazol-4-yl)acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl] N-(4,4,4-trifluorobutan-2-yl)carbamate |
| SMILES | Cc1c(CC(=O)Nc2cc([C@H]3CC[C@@H](OC(=O)NC(C)CC(F)(F)F)C3)[nH]n2)cnn1C |
| InChI | InChI=1S/C20H27F3N6O3/c1-11(9-20(21,22)23)25-19(31)32-15-5-4-13(6-15)16-8-17(28-27-16)26-18(30)7-14-10-24-29(3)12(14)2/h8,10-11,13,15H,4-7,9H2,1-3H3,(H,25,31)(H2,26,27,28,30)/t11?,13-,15+/m0/s1 |
| InChIKey | AYTVCTXUVCOWNN-RDNFXGMISA-N |
| XLogP | 3.34 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |