About 2-methyl-N,N-bis(trichlorosilyl)propan-1-amine
2-methyl-N,N-bis(trichlorosilyl)propan-1-amine (PubChem CID 154617735) has the molecular formula C4H9Cl6NSi2
and a molecular weight of 340.01 g/mol. Its IUPAC name is 2-methyl-N,N-bis(trichlorosilyl)propan-1-amine.
Molecular Properties
| Compound Name | 2-methyl-N,N-bis(trichlorosilyl)propan-1-amine |
| PubChem CID | 154617735 |
| Molecular Formula | C4H9Cl6NSi2 |
| Molecular Weight | 340.01 g/mol |
| Exact Mass | 336.84 |
| IUPAC Name | 2-methyl-N,N-bis(trichlorosilyl)propan-1-amine |
| SMILES | CC(C)CN([Si](Cl)(Cl)Cl)[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C4H9Cl6NSi2/c1-4(2)3-11(12(5,6)7)13(8,9)10/h4H,3H2,1-2H3 |
| InChIKey | MPYPFHSCCXYVTH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.01 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N,N-bis(trichlorosilyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N,N-bis(trichlorosilyl)propan-1-amine?
The IUPAC name of 2-methyl-N,N-bis(trichlorosilyl)propan-1-amine (CID 154617735) is 2-methyl-N,N-bis(trichlorosilyl)propan-1-amine.
What is the SMILES notation for 2-methyl-N,N-bis(trichlorosilyl)propan-1-amine?
The canonical SMILES for 2-methyl-N,N-bis(trichlorosilyl)propan-1-amine is CC(C)CN([Si](Cl)(Cl)Cl)[Si](Cl)(Cl)Cl.
What is the InChIKey of 2-methyl-N,N-bis(trichlorosilyl)propan-1-amine?
The InChIKey is MPYPFHSCCXYVTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9Cl6NSi2/c1-4(2)3-11(12(5,6)7)13(8,9)10/h4H,3H2,1-2H3.
What are the key properties of 2-methyl-N,N-bis(trichlorosilyl)propan-1-amine?
2-methyl-N,N-bis(trichlorosilyl)propan-1-amine has a molecular weight of 340.01 g/mol, XLogP of 4.25, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N,N-bis(trichlorosilyl)propan-1-amine is sourced from PubChem (CID 154617735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).