C37H49N7O4 — CID 154618510
N-[(1S)-1-cyclohexyl-2-oxo-2-[4-[(2R)-3-oxo-3-[4-(1-phenylethyl)piperazin-1-yl]-2-(propanoylamino)propyl]anilino]ethyl]-2-methylpyrazole-3-carboxamide (PubChem CID 154618510) has the molecular formula C37H49N7O4 and a molecular weight of 655.84 g/mol. Its IUPAC name is N-[(1S)-1-cyclohexyl-2-oxo-2-[4-[(2R)-3-oxo-3-[4-(1-phenylethyl)piperazin-1-yl]-2-(propanoylamino)propyl]anilino]ethyl]-2-methylpyrazole-3-carboxamide.
| Compound Name | N-[(1S)-1-cyclohexyl-2-oxo-2-[4-[(2R)-3-oxo-3-[4-(1-phenylethyl)piperazin-1-yl]-2-(propanoylamino)propyl]anilino]ethyl]-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 154618510 |
| Molecular Formula | C37H49N7O4 |
| Molecular Weight | 655.84 g/mol |
| Exact Mass | 655.38 |
| IUPAC Name | N-[(1S)-1-cyclohexyl-2-oxo-2-[4-[(2R)-3-oxo-3-[4-(1-phenylethyl)piperazin-1-yl]-2-(propanoylamino)propyl]anilino]ethyl]-2-methylpyrazole-3-carboxamide |
| SMILES | CCC(=O)N[C@H](Cc1ccc(NC(=O)[C@@H](NC(=O)c2ccnn2C)C2CCCCC2)cc1)C(=O)N1CCN(C(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C37H49N7O4/c1-4-33(45)40-31(37(48)44-23-21-43(22-24-44)26(2)28-11-7-5-8-12-28)25-27-15-17-30(18-16-27)39-36(47)34(29-13-9-6-10-14-29)41-35(46)32-19-20-38-42(32)3/h5,7-8,11-12,15-20,26,29,31,34H,4,6,9-10,13-14,21-25H2,1-3H3,(H,39,47)(H,40,45)(H,41,46)/t26?,31-,34+/m1/s1 |
| InChIKey | ARBYLTQPXNUCSK-ANBZJBNFSA-N |
| XLogP | 4.08 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.84 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |