C26H32IrN4Si-2 — CID 154618964
[2,3-dimethyl-3-(1-phenyl-3-phenyl-2H-imidazo[4,5-b]pyrazin-2-id-5-yl)butan-2-yl]-trimethylsilane;iridium (PubChem CID 154618964) has the molecular formula C26H32IrN4Si-2 and a molecular weight of 620.87 g/mol. Its IUPAC name is [2,3-dimethyl-3-(1-phenyl-3-phenyl-2H-imidazo[4,5-b]pyrazin-2-id-5-yl)butan-2-yl]-trimethylsilane;iridium.
| Compound Name | [2,3-dimethyl-3-(1-phenyl-3-phenyl-2H-imidazo[4,5-b]pyrazin-2-id-5-yl)butan-2-yl]-trimethylsilane;iridium |
|---|---|
| PubChem CID | 154618964 |
| Molecular Formula | C26H32IrN4Si-2 |
| Molecular Weight | 620.87 g/mol |
| Exact Mass | 621.20 |
| IUPAC Name | [2,3-dimethyl-3-(1-phenyl-3-phenyl-2H-imidazo[4,5-b]pyrazin-2-id-5-yl)butan-2-yl]-trimethylsilane;iridium |
| SMILES | CC(C)(c1cnc2c(n1)N(c1[c-]cccc1)[CH-]N2c1ccccc1)C(C)(C)[Si](C)(C)C.[Ir] |
| InChI | InChI=1S/C26H32N4Si.Ir/c1-25(2,26(3,4)31(5,6)7)22-18-27-23-24(28-22)30(21-16-12-9-13-17-21)19-29(23)20-14-10-8-11-15-20;/h8-16,18-19H,1-7H3;/q-2; |
| InChIKey | VICLFXADCJHQSM-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.87 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|