C44H54N8O4-2 — CID 154619735
2-[1,8-diamino-4,5,10-tris(dimethylamino)anthracen-9-yl]-4-[4,5,10-tris(dimethylamino)-1,8-dihydroxyanthracen-9-yl]cyclobutane-1,3-diolate (PubChem CID 154619735) has the molecular formula C44H54N8O4-2 and a molecular weight of 758.97 g/mol. Its IUPAC name is 2-[1,8-diamino-4,5,10-tris(dimethylamino)anthracen-9-yl]-4-[4,5,10-tris(dimethylamino)-1,8-dihydroxyanthracen-9-yl]cyclobutane-1,3-diolate.
| Compound Name | 2-[1,8-diamino-4,5,10-tris(dimethylamino)anthracen-9-yl]-4-[4,5,10-tris(dimethylamino)-1,8-dihydroxyanthracen-9-yl]cyclobutane-1,3-diolate |
|---|---|
| PubChem CID | 154619735 |
| Molecular Formula | C44H54N8O4-2 |
| Molecular Weight | 758.97 g/mol |
| Exact Mass | 758.43 |
| IUPAC Name | 2-[1,8-diamino-4,5,10-tris(dimethylamino)anthracen-9-yl]-4-[4,5,10-tris(dimethylamino)-1,8-dihydroxyanthracen-9-yl]cyclobutane-1,3-diolate |
| SMILES | CN(C)c1ccc(N)c2c(C3C([O-])C(c4c5c(O)ccc(N(C)C)c5c(N(C)C)c5c(N(C)C)ccc(O)c45)C3[O-])c3c(N)ccc(N(C)C)c3c(N(C)C)c12 |
| InChI | InChI=1S/C44H54N8O4/c1-47(2)23-15-13-21(45)29-31(23)41(51(9)10)32-24(48(3)4)16-14-22(46)30(32)37(29)39-43(55)40(44(39)56)38-35-27(53)19-17-25(49(5)6)33(35)42(52(11)12)34-26(50(7)8)18-20-28(54)36(34)38/h13-20,39-40,43-44,53-54H,45-46H2,1-12H3/q-2 |
| InChIKey | KTHNLTBGHXKYIE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 158.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.97 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|