About 1,8-dimethoxy-9,10-diphenylacridin-10-ium tetrafluoroborate
1,8-dimethoxy-9,10-diphenylacridin-10-ium tetrafluoroborate (PubChem CID 154620868) has the molecular formula C27H22BF4NO2
and a molecular weight of 479.28 g/mol. Its IUPAC name is 1,8-dimethoxy-9,10-diphenylacridin-10-ium tetrafluoroborate.
Molecular Properties
| Compound Name | 1,8-dimethoxy-9,10-diphenylacridin-10-ium tetrafluoroborate |
| PubChem CID | 154620868 |
| Molecular Formula | C27H22BF4NO2 |
| Molecular Weight | 479.28 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 1,8-dimethoxy-9,10-diphenylacridin-10-ium tetrafluoroborate |
| SMILES | COc1cccc2c1c(-c1ccccc1)c1c(OC)cccc1[n+]2-c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C27H22NO2.BF4/c1-29-23-17-9-15-21-26(23)25(19-11-5-3-6-12-19)27-22(16-10-18-24(27)30-2)28(21)20-13-7-4-8-14-20;2-1(3,4)5/h3-18H,1-2H3;/q+1;-1 |
| InChIKey | GTVNVTOQSYWFBD-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.28 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,8-dimethoxy-9,10-diphenylacridin-10-ium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-dimethoxy-9,10-diphenylacridin-10-ium tetrafluoroborate?
The IUPAC name of 1,8-dimethoxy-9,10-diphenylacridin-10-ium tetrafluoroborate (CID 154620868) is 1,8-dimethoxy-9,10-diphenylacridin-10-ium tetrafluoroborate.
What is the SMILES notation for 1,8-dimethoxy-9,10-diphenylacridin-10-ium tetrafluoroborate?
The canonical SMILES for 1,8-dimethoxy-9,10-diphenylacridin-10-ium tetrafluoroborate is COc1cccc2c1c(-c1ccccc1)c1c(OC)cccc1[n+]2-c1ccccc1.F[B-](F)(F)F.
What is the InChIKey of 1,8-dimethoxy-9,10-diphenylacridin-10-ium tetrafluoroborate?
The InChIKey is GTVNVTOQSYWFBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22NO2.BF4/c1-29-23-17-9-15-21-26(23)25(19-11-5-3-6-12-19)27-22(16-10-18-24(27)30-2)28(21)20-13-7-4-8-14-20;2-1(3,4)5/h3-18H,1-2H3;/q+1;-1.
What are the key properties of 1,8-dimethoxy-9,10-diphenylacridin-10-ium tetrafluoroborate?
1,8-dimethoxy-9,10-diphenylacridin-10-ium tetrafluoroborate has a molecular weight of 479.28 g/mol, XLogP of 7.25, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-dimethoxy-9,10-diphenylacridin-10-ium tetrafluoroborate is sourced from PubChem (CID 154620868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).