C34H41N3O9SSi — CID 154621002
[(3R,4S,5S)-2-acetyloxy-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[2-(4-methylphenyl)sulfonyloxyethyl]oxolan-3-yl] acetate (PubChem CID 154621002) has the molecular formula C34H41N3O9SSi and a molecular weight of 695.87 g/mol. Its IUPAC name is [(3R,4S,5S)-2-acetyloxy-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[2-(4-methylphenyl)sulfonyloxyethyl]oxolan-3-yl] acetate.
| Compound Name | [(3R,4S,5S)-2-acetyloxy-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[2-(4-methylphenyl)sulfonyloxyethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 154621002 |
| Molecular Formula | C34H41N3O9SSi |
| Molecular Weight | 695.87 g/mol |
| Exact Mass | 695.23 |
| IUPAC Name | [(3R,4S,5S)-2-acetyloxy-4-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[2-(4-methylphenyl)sulfonyloxyethyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1O[C@](CCOS(=O)(=O)c2ccc(C)cc2)(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](N=[N+]=[N-])[C@H]1OC(C)=O |
| InChI | InChI=1S/C34H41N3O9SSi/c1-24-17-19-27(20-18-24)47(40,41)42-22-21-34(31(36-37-35)30(44-25(2)38)32(46-34)45-26(3)39)23-43-48(33(4,5)6,28-13-9-7-10-14-28)29-15-11-8-12-16-29/h7-20,30-32H,21-23H2,1-6H3/t30-,31+,32?,34-/m1/s1 |
| InChIKey | VHDVGUVHYGTAKV-HHPZPXBESA-N |
| XLogP | 4.94 |
| TPSA | 163.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.87 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|