C27H45NO — CID 154621226
(1R,2R,5S)-N-[(4-methoxyphenyl)methyl]-2,6,6-trimethyl-N-nonylbicyclo[3.1.1]heptan-3-amine (PubChem CID 154621226) has the molecular formula C27H45NO and a molecular weight of 399.66 g/mol. Its IUPAC name is (1R,2R,5S)-N-[(4-methoxyphenyl)methyl]-2,6,6-trimethyl-N-nonylbicyclo[3.1.1]heptan-3-amine.
| Compound Name | (1R,2R,5S)-N-[(4-methoxyphenyl)methyl]-2,6,6-trimethyl-N-nonylbicyclo[3.1.1]heptan-3-amine |
|---|---|
| PubChem CID | 154621226 |
| Molecular Formula | C27H45NO |
| Molecular Weight | 399.66 g/mol |
| Exact Mass | 399.35 |
| IUPAC Name | (1R,2R,5S)-N-[(4-methoxyphenyl)methyl]-2,6,6-trimethyl-N-nonylbicyclo[3.1.1]heptan-3-amine |
| SMILES | CCCCCCCCCN(Cc1ccc(OC)cc1)C1C[C@@H]2C[C@H]([C@H]1C)C2(C)C |
| InChI | InChI=1S/C27H45NO/c1-6-7-8-9-10-11-12-17-28(20-22-13-15-24(29-5)16-14-22)26-19-23-18-25(21(26)2)27(23,3)4/h13-16,21,23,25-26H,6-12,17-20H2,1-5H3/t21-,23+,25-,26?/m1/s1 |
| InChIKey | YEXRZLOGCVSZJD-LKKBWZENSA-N |
| XLogP | 7.32 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.66 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|