About bis[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl] (E)-hex-3-enedioate
bis[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl] (E)-hex-3-enedioate (PubChem CID 154621400) has the molecular formula C16H16O10
and a molecular weight of 368.29 g/mol. Its IUPAC name is bis[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl] (E)-hex-3-enedioate.
Molecular Properties
| Compound Name | bis[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl] (E)-hex-3-enedioate |
| PubChem CID | 154621400 |
| Molecular Formula | C16H16O10 |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | bis[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl] (E)-hex-3-enedioate |
| SMILES | Cc1oc(=O)oc1COC(=O)C/C=C/CC(=O)OCc1oc(=O)oc1C |
| InChI | InChI=1S/C16H16O10/c1-9-11(25-15(19)23-9)7-21-13(17)5-3-4-6-14(18)22-8-12-10(2)24-16(20)26-12/h3-4H,5-8H2,1-2H3/b4-3+ |
| InChIKey | NMQIVAGICCGMML-ONEGZZNKSA-N |
| XLogP | 1.52 |
| TPSA | 139.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl] (E)-hex-3-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl] (E)-hex-3-enedioate?
The IUPAC name of bis[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl] (E)-hex-3-enedioate (CID 154621400) is bis[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl] (E)-hex-3-enedioate.
What is the SMILES notation for bis[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl] (E)-hex-3-enedioate?
The canonical SMILES for bis[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl] (E)-hex-3-enedioate is Cc1oc(=O)oc1COC(=O)C/C=C/CC(=O)OCc1oc(=O)oc1C.
What is the InChIKey of bis[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl] (E)-hex-3-enedioate?
The InChIKey is NMQIVAGICCGMML-ONEGZZNKSA-N. The full InChI is InChI=1S/C16H16O10/c1-9-11(25-15(19)23-9)7-21-13(17)5-3-4-6-14(18)22-8-12-10(2)24-16(20)26-12/h3-4H,5-8H2,1-2H3/b4-3+.
What are the key properties of bis[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl] (E)-hex-3-enedioate?
bis[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl] (E)-hex-3-enedioate has a molecular weight of 368.29 g/mol, XLogP of 1.52, 8 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl] (E)-hex-3-enedioate is sourced from PubChem (CID 154621400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).