C22H28O10 — CID 154621402
bis[(3E)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] (E)-hex-3-enedioate (PubChem CID 154621402) has the molecular formula C22H28O10 and a molecular weight of 452.46 g/mol. Its IUPAC name is bis[(3E)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] (E)-hex-3-enedioate.
| Compound Name | bis[(3E)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] (E)-hex-3-enedioate |
|---|---|
| PubChem CID | 154621402 |
| Molecular Formula | C22H28O10 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | bis[(3E)-3-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl] (E)-hex-3-enedioate |
| SMILES | CC1(C)OC(=O)O/C1=C/CCOC(=O)C/C=C/CC(=O)OCC/C=C1/OC(=O)OC1(C)C |
| InChI | InChI=1S/C22H28O10/c1-21(2)15(29-19(25)31-21)9-7-13-27-17(23)11-5-6-12-18(24)28-14-8-10-16-22(3,4)32-20(26)30-16/h5-6,9-10H,7-8,11-14H2,1-4H3/b6-5+,15-9+,16-10+ |
| InChIKey | MINXVMZIBMOIDK-UQBUUWLASA-N |
| XLogP | 3.85 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|