C17H24INO3 — CID 154621830
tert-butyl 5-(3-iodopropoxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 154621830) has the molecular formula C17H24INO3 and a molecular weight of 417.29 g/mol. Its IUPAC name is tert-butyl 5-(3-iodopropoxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 5-(3-iodopropoxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 154621830 |
| Molecular Formula | C17H24INO3 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | tert-butyl 5-(3-iodopropoxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(cccc2OCCCI)C1 |
| InChI | InChI=1S/C17H24INO3/c1-17(2,3)22-16(20)19-10-8-14-13(12-19)6-4-7-15(14)21-11-5-9-18/h4,6-7H,5,8-12H2,1-3H3 |
| InChIKey | BDELYOVKFVZYOS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|