C22H34FN3O5S — CID 154622581
methyl (2R,3S,5R)-2-[[(1S,3R,4R)-3,4-dideuterio-4-(3-fluorophenyl)cyclohexyl]oxymethyl]-3-(dimethylsulfamoylamino)-5-methylpyrrolidine-1-carboxylate (PubChem CID 154622581) has the molecular formula C22H34FN3O5S and a molecular weight of 473.61 g/mol. Its IUPAC name is methyl (2R,3S,5R)-2-[[(1S,3R,4R)-3,4-dideuterio-4-(3-fluorophenyl)cyclohexyl]oxymethyl]-3-(dimethylsulfamoylamino)-5-methylpyrrolidine-1-carboxylate.
| Compound Name | methyl (2R,3S,5R)-2-[[(1S,3R,4R)-3,4-dideuterio-4-(3-fluorophenyl)cyclohexyl]oxymethyl]-3-(dimethylsulfamoylamino)-5-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 154622581 |
| Molecular Formula | C22H34FN3O5S |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | methyl (2R,3S,5R)-2-[[(1S,3R,4R)-3,4-dideuterio-4-(3-fluorophenyl)cyclohexyl]oxymethyl]-3-(dimethylsulfamoylamino)-5-methylpyrrolidine-1-carboxylate |
| SMILES | [2H][C@@H]1C[C@@H](OC[C@H]2[C@@H](NS(=O)(=O)N(C)C)C[C@@H](C)N2C(=O)OC)CC[C@@]1([2H])c1cccc(F)c1 |
| InChI | InChI=1S/C22H34FN3O5S/c1-15-12-20(24-32(28,29)25(2)3)21(26(15)22(27)30-4)14-31-19-10-8-16(9-11-19)17-6-5-7-18(23)13-17/h5-7,13,15-16,19-21,24H,8-12,14H2,1-4H3/t15-,16-,19+,20+,21+/m1/s1/i8D,16D/t8-,15-,16+,19-,20+,21+ |
| InChIKey | VRCBPPQSWQSLSW-QQQLQBHZSA-N |
| XLogP | 2.86 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |