C20H28FN3O3 — CID 154622942
4-[3-(4-fluorooxan-4-yl)-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]pyridine-2-carboxamide (PubChem CID 154622942) has the molecular formula C20H28FN3O3 and a molecular weight of 377.46 g/mol. Its IUPAC name is 4-[3-(4-fluorooxan-4-yl)-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]pyridine-2-carboxamide.
| Compound Name | 4-[3-(4-fluorooxan-4-yl)-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 154622942 |
| Molecular Formula | C20H28FN3O3 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 4-[3-(4-fluorooxan-4-yl)-9-methoxy-3-azabicyclo[3.3.1]nonan-9-yl]pyridine-2-carboxamide |
| SMILES | COC1(c2ccnc(C(N)=O)c2)C2CCCC1CN(C1(F)CCOCC1)C2 |
| InChI | InChI=1S/C20H28FN3O3/c1-26-20(14-5-8-23-17(11-14)18(22)25)15-3-2-4-16(20)13-24(12-15)19(21)6-9-27-10-7-19/h5,8,11,15-16H,2-4,6-7,9-10,12-13H2,1H3,(H2,22,25) |
| InChIKey | POMATSJOAZAMHU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|