C13H24F5O7Rf- — CID 154623563
1-(2,2-difluoroethoxy)-3-(2-fluoroethoxy)propan-2-ol;4-(2,2-difluoro-2-hydroxyethoxy)butane-1,3-diol;rutherfordium (PubChem CID 154623563) has the molecular formula C13H24F5O7Rf- and a molecular weight of 654.32 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)-3-(2-fluoroethoxy)propan-2-ol;4-(2,2-difluoro-2-hydroxyethoxy)butane-1,3-diol;rutherfordium.
| Compound Name | 1-(2,2-difluoroethoxy)-3-(2-fluoroethoxy)propan-2-ol;4-(2,2-difluoro-2-hydroxyethoxy)butane-1,3-diol;rutherfordium |
|---|---|
| PubChem CID | 154623563 |
| Molecular Formula | C13H24F5O7Rf- |
| Molecular Weight | 654.32 g/mol |
| Exact Mass | 654.27 |
| IUPAC Name | 1-(2,2-difluoroethoxy)-3-(2-fluoroethoxy)propan-2-ol;4-(2,2-difluoro-2-hydroxyethoxy)butane-1,3-diol;rutherfordium |
| SMILES | OC(COCCF)COC[C-](F)F.OCCC(O)COCC(O)(F)F.[Rf] |
| InChI | InChI=1S/C7H12F3O3.C6H12F2O4.Rf/c8-1-2-12-3-6(11)4-13-5-7(9)10;7-6(8,11)4-12-3-5(10)1-2-9;/h6,11H,1-5H2;5,9-11H,1-4H2;/q-1;; |
| InChIKey | DFQYAPUUPPQLMI-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.32 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|