C22H56N2O5Si5 — CID 154624355
4-[3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy-methyl-trimethylsilyloxysilyl]propoxy]-2,6,6-trimethylpiperidin-2-amine (PubChem CID 154624355) has the molecular formula C22H56N2O5Si5 and a molecular weight of 569.13 g/mol. Its IUPAC name is 4-[3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy-methyl-trimethylsilyloxysilyl]propoxy]-2,6,6-trimethylpiperidin-2-amine.
| Compound Name | 4-[3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy-methyl-trimethylsilyloxysilyl]propoxy]-2,6,6-trimethylpiperidin-2-amine |
|---|---|
| PubChem CID | 154624355 |
| Molecular Formula | C22H56N2O5Si5 |
| Molecular Weight | 569.13 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 4-[3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy-methyl-trimethylsilyloxysilyl]propoxy]-2,6,6-trimethylpiperidin-2-amine |
| SMILES | CC1(C)CC(OCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C)CC(C)(N)N1 |
| InChI | InChI=1S/C22H56N2O5Si5/c1-21(2)18-20(19-22(3,23)24-21)25-16-15-17-34(14,27-31(7,8)9)29-33(12,13)28-32(10,11)26-30(4,5)6/h20,24H,15-19,23H2,1-14H3 |
| InChIKey | YHLHVFFPYVTUEV-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.13 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|