C28H35N3O5 — CID 15462619
2-(4-hydroxyphenyl)ethyl (6S,9aS)-6-benzyl-4,7-dioxo-8-pentyl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 15462619) has the molecular formula C28H35N3O5 and a molecular weight of 493.60 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)ethyl (6S,9aS)-6-benzyl-4,7-dioxo-8-pentyl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | 2-(4-hydroxyphenyl)ethyl (6S,9aS)-6-benzyl-4,7-dioxo-8-pentyl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 15462619 |
| Molecular Formula | C28H35N3O5 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | 2-(4-hydroxyphenyl)ethyl (6S,9aS)-6-benzyl-4,7-dioxo-8-pentyl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | CCCCCN1C[C@@H]2N(C(=O)OCCc3ccc(O)cc3)CCC(=O)N2[C@@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C28H35N3O5/c1-2-3-7-16-29-20-25-30(28(35)36-18-15-21-10-12-23(32)13-11-21)17-14-26(33)31(25)24(27(29)34)19-22-8-5-4-6-9-22/h4-6,8-13,24-25,32H,2-3,7,14-20H2,1H3/t24-,25+/m0/s1 |
| InChIKey | MPKAXRHERSIYLD-LOSJGSFVSA-N |
| XLogP | 3.58 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|