C33H38N4O4S2 — CID 15462641
ethyl 11-(diethylaminomethyl)-13-(3,4-dimethoxyphenyl)-5-(phenylcarbamothioyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carboxylate (PubChem CID 15462641) has the molecular formula C33H38N4O4S2 and a molecular weight of 618.83 g/mol. Its IUPAC name is ethyl 11-(diethylaminomethyl)-13-(3,4-dimethoxyphenyl)-5-(phenylcarbamothioyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carboxylate.
| Compound Name | ethyl 11-(diethylaminomethyl)-13-(3,4-dimethoxyphenyl)-5-(phenylcarbamothioyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carboxylate |
|---|---|
| PubChem CID | 15462641 |
| Molecular Formula | C33H38N4O4S2 |
| Molecular Weight | 618.83 g/mol |
| Exact Mass | 618.23 |
| IUPAC Name | ethyl 11-(diethylaminomethyl)-13-(3,4-dimethoxyphenyl)-5-(phenylcarbamothioyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-12-carboxylate |
| SMILES | CCOC(=O)c1c(CN(CC)CC)nc2sc3c(c2c1-c1ccc(OC)c(OC)c1)CCN(C(=S)Nc1ccccc1)C3 |
| InChI | InChI=1S/C33H38N4O4S2/c1-6-36(7-2)19-24-30(32(38)41-8-3)28(21-14-15-25(39-4)26(18-21)40-5)29-23-16-17-37(20-27(23)43-31(29)35-24)33(42)34-22-12-10-9-11-13-22/h9-15,18H,6-8,16-17,19-20H2,1-5H3,(H,34,42) |
| InChIKey | IWCLKMWNIPXTFP-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.83 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|