About ethyl 3-[4-(6H-benzo[c][1,5]benzothiazepin-11-yl)piperidin-1-yl]propanoate
ethyl 3-[4-(6H-benzo[c][1,5]benzothiazepin-11-yl)piperidin-1-yl]propanoate (PubChem CID 15462712) has the molecular formula C23H28N2O2S
and a molecular weight of 396.56 g/mol. Its IUPAC name is ethyl 3-[4-(6H-benzo[c][1,5]benzothiazepin-11-yl)piperidin-1-yl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[4-(6H-benzo[c][1,5]benzothiazepin-11-yl)piperidin-1-yl]propanoate |
| PubChem CID | 15462712 |
| Molecular Formula | C23H28N2O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | ethyl 3-[4-(6H-benzo[c][1,5]benzothiazepin-11-yl)piperidin-1-yl]propanoate |
| SMILES | CCOC(=O)CCN1CCC(N2c3ccccc3CSc3ccccc32)CC1 |
| InChI | InChI=1S/C23H28N2O2S/c1-2-27-23(26)13-16-24-14-11-19(12-15-24)25-20-8-4-3-7-18(20)17-28-22-10-6-5-9-21(22)25/h3-10,19H,2,11-17H2,1H3 |
| InChIKey | HURUVSFCRSWIFR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-[4-(6H-benzo[c][1,5]benzothiazepin-11-yl)piperidin-1-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[4-(6H-benzo[c][1,5]benzothiazepin-11-yl)piperidin-1-yl]propanoate?
The IUPAC name of ethyl 3-[4-(6H-benzo[c][1,5]benzothiazepin-11-yl)piperidin-1-yl]propanoate (CID 15462712) is ethyl 3-[4-(6H-benzo[c][1,5]benzothiazepin-11-yl)piperidin-1-yl]propanoate.
What is the SMILES notation for ethyl 3-[4-(6H-benzo[c][1,5]benzothiazepin-11-yl)piperidin-1-yl]propanoate?
The canonical SMILES for ethyl 3-[4-(6H-benzo[c][1,5]benzothiazepin-11-yl)piperidin-1-yl]propanoate is CCOC(=O)CCN1CCC(N2c3ccccc3CSc3ccccc32)CC1.
What is the InChIKey of ethyl 3-[4-(6H-benzo[c][1,5]benzothiazepin-11-yl)piperidin-1-yl]propanoate?
The InChIKey is HURUVSFCRSWIFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2O2S/c1-2-27-23(26)13-16-24-14-11-19(12-15-24)25-20-8-4-3-7-18(20)17-28-22-10-6-5-9-21(22)25/h3-10,19H,2,11-17H2,1H3.
What are the key properties of ethyl 3-[4-(6H-benzo[c][1,5]benzothiazepin-11-yl)piperidin-1-yl]propanoate?
ethyl 3-[4-(6H-benzo[c][1,5]benzothiazepin-11-yl)piperidin-1-yl]propanoate has a molecular weight of 396.56 g/mol, XLogP of 4.85, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[4-(6H-benzo[c][1,5]benzothiazepin-11-yl)piperidin-1-yl]propanoate is sourced from PubChem (CID 15462712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).