About 3-methoxy-4-(1,3-oxazol-5-yl)aniline
3-methoxy-4-(1,3-oxazol-5-yl)aniline (PubChem CID 15462732) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is 3-methoxy-4-(1,3-oxazol-5-yl)aniline.
Molecular Properties
| Compound Name | 3-methoxy-4-(1,3-oxazol-5-yl)aniline |
| PubChem CID | 15462732 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 3-methoxy-4-(1,3-oxazol-5-yl)aniline |
| SMILES | COc1cc(N)ccc1-c1cnco1 |
| InChI | InChI=1S/C10H10N2O2/c1-13-9-4-7(11)2-3-8(9)10-5-12-6-14-10/h2-6H,11H2,1H3 |
| InChIKey | KYCMMXMEXWSPCV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-4-(1,3-oxazol-5-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-4-(1,3-oxazol-5-yl)aniline?
The IUPAC name of 3-methoxy-4-(1,3-oxazol-5-yl)aniline (CID 15462732) is 3-methoxy-4-(1,3-oxazol-5-yl)aniline.
What is the SMILES notation for 3-methoxy-4-(1,3-oxazol-5-yl)aniline?
The canonical SMILES for 3-methoxy-4-(1,3-oxazol-5-yl)aniline is COc1cc(N)ccc1-c1cnco1.
What is the InChIKey of 3-methoxy-4-(1,3-oxazol-5-yl)aniline?
The InChIKey is KYCMMXMEXWSPCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-13-9-4-7(11)2-3-8(9)10-5-12-6-14-10/h2-6H,11H2,1H3.
What are the key properties of 3-methoxy-4-(1,3-oxazol-5-yl)aniline?
3-methoxy-4-(1,3-oxazol-5-yl)aniline has a molecular weight of 190.20 g/mol, XLogP of 1.93, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-4-(1,3-oxazol-5-yl)aniline is sourced from PubChem (CID 15462732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).