C26H29F3N2O3 — CID 154627592
(E)-3-[3,5-difluoro-4-[2-(2-fluoro-2-methylpropyl)-6-methoxy-3-methyl-1,3,4,4b,8a,9-hexahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid (PubChem CID 154627592) has the molecular formula C26H29F3N2O3 and a molecular weight of 474.52 g/mol. Its IUPAC name is (E)-3-[3,5-difluoro-4-[2-(2-fluoro-2-methylpropyl)-6-methoxy-3-methyl-1,3,4,4b,8a,9-hexahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-difluoro-4-[2-(2-fluoro-2-methylpropyl)-6-methoxy-3-methyl-1,3,4,4b,8a,9-hexahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 154627592 |
| Molecular Formula | C26H29F3N2O3 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | (E)-3-[3,5-difluoro-4-[2-(2-fluoro-2-methylpropyl)-6-methoxy-3-methyl-1,3,4,4b,8a,9-hexahydropyrido[3,4-b]indol-1-yl]phenyl]prop-2-enoic acid |
| SMILES | COC1=CC2C3=C(NC2C=C1)C(c1c(F)cc(/C=C/C(=O)O)cc1F)N(CC(C)(C)F)C(C)C3 |
| InChI | InChI=1S/C26H29F3N2O3/c1-14-9-18-17-12-16(34-4)6-7-21(17)30-24(18)25(31(14)13-26(2,3)29)23-19(27)10-15(11-20(23)28)5-8-22(32)33/h5-8,10-12,14,17,21,25,30H,9,13H2,1-4H3,(H,32,33)/b8-5+ |
| InChIKey | KBJJFVYYROUQGG-VMPITWQZSA-N |
| XLogP | 4.89 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|