C19H18N4O3S — CID 154627601
4-amino-1-[(4-methyl-1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)sulfonyl]-2,3-dihydroindole-6-carbonitrile (PubChem CID 154627601) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is 4-amino-1-[(4-methyl-1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)sulfonyl]-2,3-dihydroindole-6-carbonitrile.
| Compound Name | 4-amino-1-[(4-methyl-1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)sulfonyl]-2,3-dihydroindole-6-carbonitrile |
|---|---|
| PubChem CID | 154627601 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 4-amino-1-[(4-methyl-1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)sulfonyl]-2,3-dihydroindole-6-carbonitrile |
| SMILES | CC1CNC(=O)c2cccc(S(=O)(=O)N3CCc4c(N)cc(C#N)cc43)c21 |
| InChI | InChI=1S/C19H18N4O3S/c1-11-10-22-19(24)14-3-2-4-17(18(11)14)27(25,26)23-6-5-13-15(21)7-12(9-20)8-16(13)23/h2-4,7-8,11H,5-6,10,21H2,1H3,(H,22,24) |
| InChIKey | PWJWNJKQLMWZAP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|