About (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-ethyl-N-[(2R)-1-isocyanopropan-2-yl]but-2-enamide
(E)-4-(3,3-difluoropyrrolidin-1-yl)-N-ethyl-N-[(2R)-1-isocyanopropan-2-yl]but-2-enamide (PubChem CID 154627786) has the molecular formula C14H21F2N3O
and a molecular weight of 285.34 g/mol. Its IUPAC name is (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-ethyl-N-[(2R)-1-isocyanopropan-2-yl]but-2-enamide.
Molecular Properties
| Compound Name | (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-ethyl-N-[(2R)-1-isocyanopropan-2-yl]but-2-enamide |
| PubChem CID | 154627786 |
| Molecular Formula | C14H21F2N3O |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-ethyl-N-[(2R)-1-isocyanopropan-2-yl]but-2-enamide |
| SMILES | [C-]#[N+]C[C@@H](C)N(CC)C(=O)/C=C/CN1CCC(F)(F)C1 |
| InChI | InChI=1S/C14H21F2N3O/c1-4-19(12(2)10-17-3)13(20)6-5-8-18-9-7-14(15,16)11-18/h5-6,12H,4,7-11H2,1-2H3/b6-5+/t12-/m1/s1 |
| InChIKey | QJTZGSCRMBGISQ-BTDICHCPSA-N |
| XLogP | 2.04 |
| TPSA | 27.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-ethyl-N-[(2R)-1-isocyanopropan-2-yl]but-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-ethyl-N-[(2R)-1-isocyanopropan-2-yl]but-2-enamide?
The IUPAC name of (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-ethyl-N-[(2R)-1-isocyanopropan-2-yl]but-2-enamide (CID 154627786) is (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-ethyl-N-[(2R)-1-isocyanopropan-2-yl]but-2-enamide.
What is the SMILES notation for (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-ethyl-N-[(2R)-1-isocyanopropan-2-yl]but-2-enamide?
The canonical SMILES for (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-ethyl-N-[(2R)-1-isocyanopropan-2-yl]but-2-enamide is [C-]#[N+]C[C@@H](C)N(CC)C(=O)/C=C/CN1CCC(F)(F)C1.
What is the InChIKey of (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-ethyl-N-[(2R)-1-isocyanopropan-2-yl]but-2-enamide?
The InChIKey is QJTZGSCRMBGISQ-BTDICHCPSA-N. The full InChI is InChI=1S/C14H21F2N3O/c1-4-19(12(2)10-17-3)13(20)6-5-8-18-9-7-14(15,16)11-18/h5-6,12H,4,7-11H2,1-2H3/b6-5+/t12-/m1/s1.
What are the key properties of (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-ethyl-N-[(2R)-1-isocyanopropan-2-yl]but-2-enamide?
(E)-4-(3,3-difluoropyrrolidin-1-yl)-N-ethyl-N-[(2R)-1-isocyanopropan-2-yl]but-2-enamide has a molecular weight of 285.34 g/mol, XLogP of 2.04, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(3,3-difluoropyrrolidin-1-yl)-N-ethyl-N-[(2R)-1-isocyanopropan-2-yl]but-2-enamide is sourced from PubChem (CID 154627786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).