C11H18FN3O — CID 154627888
(E)-N-ethyl-2-fluoro-N-[(2R)-1-isocyanopropan-2-yl]-4-(methylamino)but-2-enamide (PubChem CID 154627888) has the molecular formula C11H18FN3O and a molecular weight of 227.28 g/mol. Its IUPAC name is (E)-N-ethyl-2-fluoro-N-[(2R)-1-isocyanopropan-2-yl]-4-(methylamino)but-2-enamide.
| Compound Name | (E)-N-ethyl-2-fluoro-N-[(2R)-1-isocyanopropan-2-yl]-4-(methylamino)but-2-enamide |
|---|---|
| PubChem CID | 154627888 |
| Molecular Formula | C11H18FN3O |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | (E)-N-ethyl-2-fluoro-N-[(2R)-1-isocyanopropan-2-yl]-4-(methylamino)but-2-enamide |
| SMILES | [C-]#[N+]C[C@@H](C)N(CC)C(=O)/C(F)=C\CNC |
| InChI | InChI=1S/C11H18FN3O/c1-5-15(9(2)8-14-4)11(16)10(12)6-7-13-3/h6,9,13H,5,7-8H2,1-3H3/b10-6+/t9-/m1/s1 |
| InChIKey | MJRHTNFMPDXPJN-ZFZMKPAXSA-N |
| XLogP | 1.22 |
| TPSA | 36.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|