C32H23NO2SSi — CID 154627973
2-[(9,9-dimethyl-4-phenylthieno[3,2-b][1,4]benzazasilin-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 154627973) has the molecular formula C32H23NO2SSi and a molecular weight of 513.69 g/mol. Its IUPAC name is 2-[(9,9-dimethyl-4-phenylthieno[3,2-b][1,4]benzazasilin-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[(9,9-dimethyl-4-phenylthieno[3,2-b][1,4]benzazasilin-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 154627973 |
| Molecular Formula | C32H23NO2SSi |
| Molecular Weight | 513.69 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | 2-[(9,9-dimethyl-4-phenylthieno[3,2-b][1,4]benzazasilin-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | C[Si]1(C)c2ccccc2N(c2ccccc2)c2cc(C=C3C(=O)c4cc5ccccc5cc4C3=O)sc21 |
| InChI | InChI=1S/C32H23NO2SSi/c1-37(2)29-15-9-8-14-27(29)33(22-12-4-3-5-13-22)28-19-23(36-32(28)37)18-26-30(34)24-16-20-10-6-7-11-21(20)17-25(24)31(26)35/h3-19H,1-2H3 |
| InChIKey | DLHJQWNBIWNXAK-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.69 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|