C35H29NO2S2 — CID 154627992
2-[[10-tert-butyl-7-(2,4,6-trimethylphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 154627992) has the molecular formula C35H29NO2S2 and a molecular weight of 559.76 g/mol. Its IUPAC name is 2-[[10-tert-butyl-7-(2,4,6-trimethylphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[[10-tert-butyl-7-(2,4,6-trimethylphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 154627992 |
| Molecular Formula | C35H29NO2S2 |
| Molecular Weight | 559.76 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 2-[[10-tert-butyl-7-(2,4,6-trimethylphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | Cc1cc(C)c(-n2c3cc(C=C4C(=O)c5cc6ccccc6cc5C4=O)sc3c3sc(C(C)(C)C)cc32)c(C)c1 |
| InChI | InChI=1S/C35H29NO2S2/c1-18-11-19(2)30(20(3)12-18)36-27-16-23(39-33(27)34-28(36)17-29(40-34)35(4,5)6)15-26-31(37)24-13-21-9-7-8-10-22(21)14-25(24)32(26)38/h7-17H,1-6H3 |
| InChIKey | CNJVTCCFQDYXCF-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.76 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|