C32H25NO2S2 — CID 154627997
(2E)-2-[[7-ethyl-10-(2,4,6-trimethylphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]benzo[f][1]benzofuran-3-one (PubChem CID 154627997) has the molecular formula C32H25NO2S2 and a molecular weight of 519.69 g/mol. Its IUPAC name is (2E)-2-[[7-ethyl-10-(2,4,6-trimethylphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]benzo[f][1]benzofuran-3-one.
| Compound Name | (2E)-2-[[7-ethyl-10-(2,4,6-trimethylphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]benzo[f][1]benzofuran-3-one |
|---|---|
| PubChem CID | 154627997 |
| Molecular Formula | C32H25NO2S2 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | (2E)-2-[[7-ethyl-10-(2,4,6-trimethylphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]benzo[f][1]benzofuran-3-one |
| SMILES | CCn1c2cc(/C=C3/Oc4cc5ccccc5cc4C3=O)sc2c2sc(-c3c(C)cc(C)cc3C)cc21 |
| InChI | InChI=1S/C32H25NO2S2/c1-5-33-24-14-22(15-27-30(34)23-12-20-8-6-7-9-21(20)13-26(23)35-27)36-31(24)32-25(33)16-28(37-32)29-18(3)10-17(2)11-19(29)4/h6-16H,5H2,1-4H3/b27-15+ |
| InChIKey | OCZVUOAHOUMBDR-JFLMPSFJSA-N |
| XLogP | 9.30 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|