About pentacyclo[10.2.1.02,8.02,11.04,9]pentadec-5-ene
pentacyclo[10.2.1.02,8.02,11.04,9]pentadec-5-ene (PubChem CID 154628499) has the molecular formula C15H20
and a molecular weight of 200.32 g/mol. Its IUPAC name is pentacyclo[10.2.1.02,8.02,11.04,9]pentadec-5-ene.
Molecular Properties
| Compound Name | pentacyclo[10.2.1.02,8.02,11.04,9]pentadec-5-ene |
| PubChem CID | 154628499 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | pentacyclo[10.2.1.02,8.02,11.04,9]pentadec-5-ene |
| SMILES | C1=CC2CC34C5CCC(C5)C3CC2C4C1 |
| InChI | InChI=1S/C15H20/c1-2-10-8-15-11-5-4-9(6-11)14(15)7-12(10)13(15)3-1/h1-2,9-14H,3-8H2 |
| InChIKey | QIYQKFRHMPZKLV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pentacyclo[10.2.1.02,8.02,11.04,9]pentadec-5-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentacyclo[10.2.1.02,8.02,11.04,9]pentadec-5-ene?
The IUPAC name of pentacyclo[10.2.1.02,8.02,11.04,9]pentadec-5-ene (CID 154628499) is pentacyclo[10.2.1.02,8.02,11.04,9]pentadec-5-ene.
What is the SMILES notation for pentacyclo[10.2.1.02,8.02,11.04,9]pentadec-5-ene?
The canonical SMILES for pentacyclo[10.2.1.02,8.02,11.04,9]pentadec-5-ene is C1=CC2CC34C5CCC(C5)C3CC2C4C1.
What is the InChIKey of pentacyclo[10.2.1.02,8.02,11.04,9]pentadec-5-ene?
The InChIKey is QIYQKFRHMPZKLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20/c1-2-10-8-15-11-5-4-9(6-11)14(15)7-12(10)13(15)3-1/h1-2,9-14H,3-8H2.
What are the key properties of pentacyclo[10.2.1.02,8.02,11.04,9]pentadec-5-ene?
pentacyclo[10.2.1.02,8.02,11.04,9]pentadec-5-ene has a molecular weight of 200.32 g/mol, XLogP of 3.63, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pentacyclo[10.2.1.02,8.02,11.04,9]pentadec-5-ene is sourced from PubChem (CID 154628499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).