C26H34BrF2N3O3Si — CID 154629076
tert-butyl N-[1-[6-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-5-yl]-2-(3,5-difluorophenyl)ethyl]carbamate (PubChem CID 154629076) has the molecular formula C26H34BrF2N3O3Si and a molecular weight of 582.56 g/mol. Its IUPAC name is tert-butyl N-[1-[6-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-5-yl]-2-(3,5-difluorophenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[6-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-5-yl]-2-(3,5-difluorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 154629076 |
| Molecular Formula | C26H34BrF2N3O3Si |
| Molecular Weight | 582.56 g/mol |
| Exact Mass | 581.15 |
| IUPAC Name | tert-butyl N-[1-[6-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-5-yl]-2-(3,5-difluorophenyl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cc(F)cc(F)c1)c1nc2ccn(COCC[Si](C)(C)C)c2cc1Br |
| InChI | InChI=1S/C26H34BrF2N3O3Si/c1-26(2,3)35-25(33)31-22(13-17-11-18(28)14-19(29)12-17)24-20(27)15-23-21(30-24)7-8-32(23)16-34-9-10-36(4,5)6/h7-8,11-12,14-15,22H,9-10,13,16H2,1-6H3,(H,31,33) |
| InChIKey | CKQTXBGSXCGYPH-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.56 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|