C21H26BrF2N3OSi — CID 154629112
1-[6-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-5-yl]-2-(3,5-difluorophenyl)ethanamine (PubChem CID 154629112) has the molecular formula C21H26BrF2N3OSi and a molecular weight of 482.45 g/mol. Its IUPAC name is 1-[6-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-5-yl]-2-(3,5-difluorophenyl)ethanamine.
| Compound Name | 1-[6-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-5-yl]-2-(3,5-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 154629112 |
| Molecular Formula | C21H26BrF2N3OSi |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | 1-[6-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-5-yl]-2-(3,5-difluorophenyl)ethanamine |
| SMILES | C[Si](C)(C)CCOCn1ccc2nc(C(N)Cc3cc(F)cc(F)c3)c(Br)cc21 |
| InChI | InChI=1S/C21H26BrF2N3OSi/c1-29(2,3)7-6-28-13-27-5-4-19-20(27)12-17(22)21(26-19)18(25)10-14-8-15(23)11-16(24)9-14/h4-5,8-9,11-12,18H,6-7,10,13,25H2,1-3H3 |
| InChIKey | IDCZYRVVNIMIMG-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|