About 4-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-3-methyl-1,4-dihydropyrazol-5-one
4-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-3-methyl-1,4-dihydropyrazol-5-one (PubChem CID 154629417) has the molecular formula C11H8ClN3OS2
and a molecular weight of 297.79 g/mol. Its IUPAC name is 4-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-3-methyl-1,4-dihydropyrazol-5-one.
Molecular Properties
| Compound Name | 4-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-3-methyl-1,4-dihydropyrazol-5-one |
| PubChem CID | 154629417 |
| Molecular Formula | C11H8ClN3OS2 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 4-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-3-methyl-1,4-dihydropyrazol-5-one |
| SMILES | CC1=NNC(=O)C1Sc1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C11H8ClN3OS2/c1-5-9(10(16)15-14-5)18-11-13-7-4-6(12)2-3-8(7)17-11/h2-4,9H,1H3,(H,15,16) |
| InChIKey | UOIUKPXBMMZQMS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-3-methyl-1,4-dihydropyrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-3-methyl-1,4-dihydropyrazol-5-one?
The IUPAC name of 4-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-3-methyl-1,4-dihydropyrazol-5-one (CID 154629417) is 4-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-3-methyl-1,4-dihydropyrazol-5-one.
What is the SMILES notation for 4-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-3-methyl-1,4-dihydropyrazol-5-one?
The canonical SMILES for 4-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-3-methyl-1,4-dihydropyrazol-5-one is CC1=NNC(=O)C1Sc1nc2cc(Cl)ccc2s1.
What is the InChIKey of 4-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-3-methyl-1,4-dihydropyrazol-5-one?
The InChIKey is UOIUKPXBMMZQMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClN3OS2/c1-5-9(10(16)15-14-5)18-11-13-7-4-6(12)2-3-8(7)17-11/h2-4,9H,1H3,(H,15,16).
What are the key properties of 4-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-3-methyl-1,4-dihydropyrazol-5-one?
4-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-3-methyl-1,4-dihydropyrazol-5-one has a molecular weight of 297.79 g/mol, XLogP of 2.92, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-3-methyl-1,4-dihydropyrazol-5-one is sourced from PubChem (CID 154629417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).