C8H7F5O4 — CID 154630950
1-O-methyl 2-O-[(E)-4,4,5,5,5-pentafluoropent-2-enyl] oxalate (PubChem CID 154630950) has the molecular formula C8H7F5O4 and a molecular weight of 262.13 g/mol. Its IUPAC name is 1-O-methyl 2-O-[(E)-4,4,5,5,5-pentafluoropent-2-enyl] oxalate.
| Compound Name | 1-O-methyl 2-O-[(E)-4,4,5,5,5-pentafluoropent-2-enyl] oxalate |
|---|---|
| PubChem CID | 154630950 |
| Molecular Formula | C8H7F5O4 |
| Molecular Weight | 262.13 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 1-O-methyl 2-O-[(E)-4,4,5,5,5-pentafluoropent-2-enyl] oxalate |
| SMILES | COC(=O)C(=O)OC/C=C/C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H7F5O4/c1-16-5(14)6(15)17-4-2-3-7(9,10)8(11,12)13/h2-3H,4H2,1H3/b3-2+ |
| InChIKey | HHTRRPWAFPXMOT-NSCUHMNNSA-N |
| XLogP | 1.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.13 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|