C11H12N6O — CID 154630970
4-methyl-6-[(6-methylpyridazin-3-yl)amino]pyridazine-3-carboxamide (PubChem CID 154630970) has the molecular formula C11H12N6O and a molecular weight of 244.26 g/mol. Its IUPAC name is 4-methyl-6-[(6-methylpyridazin-3-yl)amino]pyridazine-3-carboxamide.
| Compound Name | 4-methyl-6-[(6-methylpyridazin-3-yl)amino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 154630970 |
| Molecular Formula | C11H12N6O |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 4-methyl-6-[(6-methylpyridazin-3-yl)amino]pyridazine-3-carboxamide |
| SMILES | Cc1ccc(Nc2cc(C)c(C(N)=O)nn2)nn1 |
| InChI | InChI=1S/C11H12N6O/c1-6-5-9(16-17-10(6)11(12)18)13-8-4-3-7(2)14-15-8/h3-5H,1-2H3,(H2,12,18)(H,13,15,16) |
| InChIKey | HIZJDYVEPKWHBP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |