C21H27F2N3O3 — CID 154631027
tert-butyl 3-(2,4-difluorophenyl)-7a-pyrrolidin-1-yl-3a,4,6,7-tetrahydro-[1,2]oxazolo[4,5-c]pyridine-5-carboxylate (PubChem CID 154631027) has the molecular formula C21H27F2N3O3 and a molecular weight of 407.46 g/mol. Its IUPAC name is tert-butyl 3-(2,4-difluorophenyl)-7a-pyrrolidin-1-yl-3a,4,6,7-tetrahydro-[1,2]oxazolo[4,5-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 3-(2,4-difluorophenyl)-7a-pyrrolidin-1-yl-3a,4,6,7-tetrahydro-[1,2]oxazolo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 154631027 |
| Molecular Formula | C21H27F2N3O3 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | tert-butyl 3-(2,4-difluorophenyl)-7a-pyrrolidin-1-yl-3a,4,6,7-tetrahydro-[1,2]oxazolo[4,5-c]pyridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(N3CCCC3)ON=C(c3ccc(F)cc3F)C2C1 |
| InChI | InChI=1S/C21H27F2N3O3/c1-20(2,3)28-19(27)25-11-8-21(26-9-4-5-10-26)16(13-25)18(24-29-21)15-7-6-14(22)12-17(15)23/h6-7,12,16H,4-5,8-11,13H2,1-3H3 |
| InChIKey | FXLVOMWGHLVTQG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |