About (2,5-dioxopyrrolidin-1-yl) [3-hydroxy-1-(2-nitrophenyl)propyl] carbonate
(2,5-dioxopyrrolidin-1-yl) [3-hydroxy-1-(2-nitrophenyl)propyl] carbonate (PubChem CID 154631249) has the molecular formula C14H14N2O8
and a molecular weight of 338.27 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) [3-hydroxy-1-(2-nitrophenyl)propyl] carbonate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) [3-hydroxy-1-(2-nitrophenyl)propyl] carbonate |
| PubChem CID | 154631249 |
| Molecular Formula | C14H14N2O8 |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) [3-hydroxy-1-(2-nitrophenyl)propyl] carbonate |
| SMILES | O=C(OC(CCO)c1ccccc1[N+](=O)[O-])ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H14N2O8/c17-8-7-11(9-3-1-2-4-10(9)16(21)22)23-14(20)24-15-12(18)5-6-13(15)19/h1-4,11,17H,5-8H2 |
| InChIKey | VNKCCIJHFUTTCG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) [3-hydroxy-1-(2-nitrophenyl)propyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) [3-hydroxy-1-(2-nitrophenyl)propyl] carbonate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) [3-hydroxy-1-(2-nitrophenyl)propyl] carbonate (CID 154631249) is (2,5-dioxopyrrolidin-1-yl) [3-hydroxy-1-(2-nitrophenyl)propyl] carbonate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) [3-hydroxy-1-(2-nitrophenyl)propyl] carbonate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) [3-hydroxy-1-(2-nitrophenyl)propyl] carbonate is O=C(OC(CCO)c1ccccc1[N+](=O)[O-])ON1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) [3-hydroxy-1-(2-nitrophenyl)propyl] carbonate?
The InChIKey is VNKCCIJHFUTTCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O8/c17-8-7-11(9-3-1-2-4-10(9)16(21)22)23-14(20)24-15-12(18)5-6-13(15)19/h1-4,11,17H,5-8H2.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) [3-hydroxy-1-(2-nitrophenyl)propyl] carbonate?
(2,5-dioxopyrrolidin-1-yl) [3-hydroxy-1-(2-nitrophenyl)propyl] carbonate has a molecular weight of 338.27 g/mol, XLogP of 1.24, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) [3-hydroxy-1-(2-nitrophenyl)propyl] carbonate is sourced from PubChem (CID 154631249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).