C24H32N6O2S — CID 154631340
5-[5-(3,5-dimethylpiperazine-1-carbothioyl)-2-ethoxyphenyl]-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one (PubChem CID 154631340) has the molecular formula C24H32N6O2S and a molecular weight of 468.63 g/mol. Its IUPAC name is 5-[5-(3,5-dimethylpiperazine-1-carbothioyl)-2-ethoxyphenyl]-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 5-[5-(3,5-dimethylpiperazine-1-carbothioyl)-2-ethoxyphenyl]-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 154631340 |
| Molecular Formula | C24H32N6O2S |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 5-[5-(3,5-dimethylpiperazine-1-carbothioyl)-2-ethoxyphenyl]-1-methyl-3-propyl-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| SMILES | CCCc1nn(C)c2c(=O)[nH]c(-c3cc(C(=S)N4CC(C)NC(C)C4)ccc3OCC)nc12 |
| InChI | InChI=1S/C24H32N6O2S/c1-6-8-18-20-21(29(5)28-18)23(31)27-22(26-20)17-11-16(9-10-19(17)32-7-2)24(33)30-12-14(3)25-15(4)13-30/h9-11,14-15,25H,6-8,12-13H2,1-5H3,(H,26,27,31) |
| InChIKey | YHJRVHRUZSXEDU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|