C11H5ClN4O8 — CID 154631386
N-(2-chloro-4,6-dinitrophenyl)-5-nitrofuran-2-carboxamide (PubChem CID 154631386) has the molecular formula C11H5ClN4O8 and a molecular weight of 356.63 g/mol. Its IUPAC name is N-(2-chloro-4,6-dinitrophenyl)-5-nitrofuran-2-carboxamide.
| Compound Name | N-(2-chloro-4,6-dinitrophenyl)-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 154631386 |
| Molecular Formula | C11H5ClN4O8 |
| Molecular Weight | 356.63 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | N-(2-chloro-4,6-dinitrophenyl)-5-nitrofuran-2-carboxamide |
| SMILES | O=C(Nc1c(Cl)cc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C11H5ClN4O8/c12-6-3-5(14(18)19)4-7(15(20)21)10(6)13-11(17)8-1-2-9(24-8)16(22)23/h1-4H,(H,13,17) |
| InChIKey | MCZJQBZWEMOCBO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 171.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.63 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|