About 9-(3-fluorophenyl)-3,6-di(propan-2-yl)carbazole
9-(3-fluorophenyl)-3,6-di(propan-2-yl)carbazole (PubChem CID 154631744) has the molecular formula C24H24FN
and a molecular weight of 345.46 g/mol. Its IUPAC name is 9-(3-fluorophenyl)-3,6-di(propan-2-yl)carbazole.
Molecular Properties
| Compound Name | 9-(3-fluorophenyl)-3,6-di(propan-2-yl)carbazole |
| PubChem CID | 154631744 |
| Molecular Formula | C24H24FN |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 9-(3-fluorophenyl)-3,6-di(propan-2-yl)carbazole |
| SMILES | CC(C)c1ccc2c(c1)c1cc(C(C)C)ccc1n2-c1cccc(F)c1 |
| InChI | InChI=1S/C24H24FN/c1-15(2)17-8-10-23-21(12-17)22-13-18(16(3)4)9-11-24(22)26(23)20-7-5-6-19(25)14-20/h5-16H,1-4H3 |
| InChIKey | CPSWGDCKSWOYPR-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-(3-fluorophenyl)-3,6-di(propan-2-yl)carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(3-fluorophenyl)-3,6-di(propan-2-yl)carbazole?
The IUPAC name of 9-(3-fluorophenyl)-3,6-di(propan-2-yl)carbazole (CID 154631744) is 9-(3-fluorophenyl)-3,6-di(propan-2-yl)carbazole.
What is the SMILES notation for 9-(3-fluorophenyl)-3,6-di(propan-2-yl)carbazole?
The canonical SMILES for 9-(3-fluorophenyl)-3,6-di(propan-2-yl)carbazole is CC(C)c1ccc2c(c1)c1cc(C(C)C)ccc1n2-c1cccc(F)c1.
What is the InChIKey of 9-(3-fluorophenyl)-3,6-di(propan-2-yl)carbazole?
The InChIKey is CPSWGDCKSWOYPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24FN/c1-15(2)17-8-10-23-21(12-17)22-13-18(16(3)4)9-11-24(22)26(23)20-7-5-6-19(25)14-20/h5-16H,1-4H3.
What are the key properties of 9-(3-fluorophenyl)-3,6-di(propan-2-yl)carbazole?
9-(3-fluorophenyl)-3,6-di(propan-2-yl)carbazole has a molecular weight of 345.46 g/mol, XLogP of 7.17, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(3-fluorophenyl)-3,6-di(propan-2-yl)carbazole is sourced from PubChem (CID 154631744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).