C7H14N6O2 — CID 154631751
2-[(4,6-diamino-1,3,5-triazin-2-yl)-ethoxyamino]ethanol (PubChem CID 154631751) has the molecular formula C7H14N6O2 and a molecular weight of 214.23 g/mol. Its IUPAC name is 2-[(4,6-diamino-1,3,5-triazin-2-yl)-ethoxyamino]ethanol.
| Compound Name | 2-[(4,6-diamino-1,3,5-triazin-2-yl)-ethoxyamino]ethanol |
|---|---|
| PubChem CID | 154631751 |
| Molecular Formula | C7H14N6O2 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 2-[(4,6-diamino-1,3,5-triazin-2-yl)-ethoxyamino]ethanol |
| SMILES | CCON(CCO)c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C7H14N6O2/c1-2-15-13(3-4-14)7-11-5(8)10-6(9)12-7/h14H,2-4H2,1H3,(H4,8,9,10,11,12) |
| InChIKey | ROIGXJXPUDCIRN-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|