C25H23N5O2 — CID 154631901
3-imidazol-1-yl-2-[[(E)-3-naphthalen-2-ylprop-2-enoyl]amino]-N-(pyridin-4-ylmethyl)propanamide (PubChem CID 154631901) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is 3-imidazol-1-yl-2-[[(E)-3-naphthalen-2-ylprop-2-enoyl]amino]-N-(pyridin-4-ylmethyl)propanamide.
| Compound Name | 3-imidazol-1-yl-2-[[(E)-3-naphthalen-2-ylprop-2-enoyl]amino]-N-(pyridin-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 154631901 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 3-imidazol-1-yl-2-[[(E)-3-naphthalen-2-ylprop-2-enoyl]amino]-N-(pyridin-4-ylmethyl)propanamide |
| SMILES | O=C(/C=C/c1ccc2ccccc2c1)NC(Cn1ccnc1)C(=O)NCc1ccncc1 |
| InChI | InChI=1S/C25H23N5O2/c31-24(8-6-19-5-7-21-3-1-2-4-22(21)15-19)29-23(17-30-14-13-27-18-30)25(32)28-16-20-9-11-26-12-10-20/h1-15,18,23H,16-17H2,(H,28,32)(H,29,31)/b8-6+ |
| InChIKey | KXVKNRDPDFZEDN-SOFGYWHQSA-N |
| XLogP | 2.95 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|