C31H29Cl3N2O4 — CID 154632057
tert-butyl (E)-3-[1-[2-(1-methoxycyclobutyl)-4-(2,4,6-trichlorophenyl)-1H-pyrrole-3-carbonyl]indol-4-yl]prop-2-enoate (PubChem CID 154632057) has the molecular formula C31H29Cl3N2O4 and a molecular weight of 599.94 g/mol. Its IUPAC name is tert-butyl (E)-3-[1-[2-(1-methoxycyclobutyl)-4-(2,4,6-trichlorophenyl)-1H-pyrrole-3-carbonyl]indol-4-yl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[1-[2-(1-methoxycyclobutyl)-4-(2,4,6-trichlorophenyl)-1H-pyrrole-3-carbonyl]indol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 154632057 |
| Molecular Formula | C31H29Cl3N2O4 |
| Molecular Weight | 599.94 g/mol |
| Exact Mass | 598.12 |
| IUPAC Name | tert-butyl (E)-3-[1-[2-(1-methoxycyclobutyl)-4-(2,4,6-trichlorophenyl)-1H-pyrrole-3-carbonyl]indol-4-yl]prop-2-enoate |
| SMILES | COC1(c2[nH]cc(-c3c(Cl)cc(Cl)cc3Cl)c2C(=O)n2ccc3c(/C=C/C(=O)OC(C)(C)C)cccc32)CCC1 |
| InChI | InChI=1S/C31H29Cl3N2O4/c1-30(2,3)40-25(37)10-9-18-7-5-8-24-20(18)11-14-36(24)29(38)27-21(26-22(33)15-19(32)16-23(26)34)17-35-28(27)31(39-4)12-6-13-31/h5,7-11,14-17,35H,6,12-13H2,1-4H3/b10-9+ |
| InChIKey | NISNHGAQTJYHLH-MDZDMXLPSA-N |
| XLogP | 8.67 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.94 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|