C16HF31O6 — CID 154632130
2,2,3,4,4,4-hexafluoro-3-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propoxy]propoxy]butanoic acid (PubChem CID 154632130) has the molecular formula C16HF31O6 and a molecular weight of 878.12 g/mol. Its IUPAC name is 2,2,3,4,4,4-hexafluoro-3-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propoxy]propoxy]butanoic acid.
| Compound Name | 2,2,3,4,4,4-hexafluoro-3-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propoxy]propoxy]butanoic acid |
|---|---|
| PubChem CID | 154632130 |
| Molecular Formula | C16HF31O6 |
| Molecular Weight | 878.12 g/mol |
| Exact Mass | 877.93 |
| IUPAC Name | 2,2,3,4,4,4-hexafluoro-3-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propoxy]propoxy]butanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16HF31O6/c17-2(18,1(48)49)4(21,9(28,29)30)50-14(42,43)6(23,11(34,35)36)52-16(46,47)7(24,12(37,38)39)53-15(44,45)5(22,10(31,32)33)51-13(40,41)3(19,20)8(25,26)27/h(H,48,49) |
| InChIKey | FSDVPQHZHRYGAB-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.12 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|