C25H39N5O5 — CID 154632187
tert-butyl 4-[tert-butylperoxycarbonyl-(5-methyl-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidine-1-carboxylate (PubChem CID 154632187) has the molecular formula C25H39N5O5 and a molecular weight of 489.62 g/mol. Its IUPAC name is tert-butyl 4-[tert-butylperoxycarbonyl-(5-methyl-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[tert-butylperoxycarbonyl-(5-methyl-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 154632187 |
| Molecular Formula | C25H39N5O5 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | tert-butyl 4-[tert-butylperoxycarbonyl-(5-methyl-3-propan-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)amino]piperidine-1-carboxylate |
| SMILES | Cc1cc(N(C(=O)OOC(C)(C)C)C2CCN(C(=O)OC(C)(C)C)CC2)n2ncc(C(C)C)c2n1 |
| InChI | InChI=1S/C25H39N5O5/c1-16(2)19-15-26-30-20(14-17(3)27-21(19)30)29(23(32)34-35-25(7,8)9)18-10-12-28(13-11-18)22(31)33-24(4,5)6/h14-16,18H,10-13H2,1-9H3 |
| InChIKey | VNRRSOVQFDJATH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 98.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|