C27H25N3O4 — CID 154632629
N-[[3-(3,4,5-trimethoxyphenoxy)phenyl]methyl]-9H-pyrido[3,4-b]indol-3-amine (PubChem CID 154632629) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is N-[[3-(3,4,5-trimethoxyphenoxy)phenyl]methyl]-9H-pyrido[3,4-b]indol-3-amine.
| Compound Name | N-[[3-(3,4,5-trimethoxyphenoxy)phenyl]methyl]-9H-pyrido[3,4-b]indol-3-amine |
|---|---|
| PubChem CID | 154632629 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | N-[[3-(3,4,5-trimethoxyphenoxy)phenyl]methyl]-9H-pyrido[3,4-b]indol-3-amine |
| SMILES | COc1cc(Oc2cccc(CNc3cc4c(cn3)[nH]c3ccccc34)c2)cc(OC)c1OC |
| InChI | InChI=1S/C27H25N3O4/c1-31-24-12-19(13-25(32-2)27(24)33-3)34-18-8-6-7-17(11-18)15-28-26-14-21-20-9-4-5-10-22(20)30-23(21)16-29-26/h4-14,16,30H,15H2,1-3H3,(H,28,29) |
| InChIKey | CNKZHOHYKWCGTD-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |