About N-[[3-(4-methylsulfanylphenoxy)phenyl]methyl]-9H-pyrido[3,4-b]indol-3-amine
N-[[3-(4-methylsulfanylphenoxy)phenyl]methyl]-9H-pyrido[3,4-b]indol-3-amine (PubChem CID 154632639) has the molecular formula C25H21N3OS
and a molecular weight of 411.53 g/mol. Its IUPAC name is N-[[3-(4-methylsulfanylphenoxy)phenyl]methyl]-9H-pyrido[3,4-b]indol-3-amine.
Molecular Properties
| Compound Name | N-[[3-(4-methylsulfanylphenoxy)phenyl]methyl]-9H-pyrido[3,4-b]indol-3-amine |
| PubChem CID | 154632639 |
| Molecular Formula | C25H21N3OS |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-[[3-(4-methylsulfanylphenoxy)phenyl]methyl]-9H-pyrido[3,4-b]indol-3-amine |
| SMILES | CSc1ccc(Oc2cccc(CNc3cc4c(cn3)[nH]c3ccccc34)c2)cc1 |
| InChI | InChI=1S/C25H21N3OS/c1-30-20-11-9-18(10-12-20)29-19-6-4-5-17(13-19)15-26-25-14-22-21-7-2-3-8-23(21)28-24(22)16-27-25/h2-14,16,28H,15H2,1H3,(H,26,27) |
| InChIKey | MCEJLACFRXVMIJ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[3-(4-methylsulfanylphenoxy)phenyl]methyl]-9H-pyrido[3,4-b]indol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-(4-methylsulfanylphenoxy)phenyl]methyl]-9H-pyrido[3,4-b]indol-3-amine?
The IUPAC name of N-[[3-(4-methylsulfanylphenoxy)phenyl]methyl]-9H-pyrido[3,4-b]indol-3-amine (CID 154632639) is N-[[3-(4-methylsulfanylphenoxy)phenyl]methyl]-9H-pyrido[3,4-b]indol-3-amine.
What is the SMILES notation for N-[[3-(4-methylsulfanylphenoxy)phenyl]methyl]-9H-pyrido[3,4-b]indol-3-amine?
The canonical SMILES for N-[[3-(4-methylsulfanylphenoxy)phenyl]methyl]-9H-pyrido[3,4-b]indol-3-amine is CSc1ccc(Oc2cccc(CNc3cc4c(cn3)[nH]c3ccccc34)c2)cc1.
What is the InChIKey of N-[[3-(4-methylsulfanylphenoxy)phenyl]methyl]-9H-pyrido[3,4-b]indol-3-amine?
The InChIKey is MCEJLACFRXVMIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21N3OS/c1-30-20-11-9-18(10-12-20)29-19-6-4-5-17(13-19)15-26-25-14-22-21-7-2-3-8-23(21)28-24(22)16-27-25/h2-14,16,28H,15H2,1H3,(H,26,27).
What are the key properties of N-[[3-(4-methylsulfanylphenoxy)phenyl]methyl]-9H-pyrido[3,4-b]indol-3-amine?
N-[[3-(4-methylsulfanylphenoxy)phenyl]methyl]-9H-pyrido[3,4-b]indol-3-amine has a molecular weight of 411.53 g/mol, XLogP of 6.84, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-(4-methylsulfanylphenoxy)phenyl]methyl]-9H-pyrido[3,4-b]indol-3-amine is sourced from PubChem (CID 154632639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).