C28H32N6O — CID 154632939
3-methyl-6-pyridin-4-yl-2-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentylamino]pyrimidin-4-one (PubChem CID 154632939) has the molecular formula C28H32N6O and a molecular weight of 468.61 g/mol. Its IUPAC name is 3-methyl-6-pyridin-4-yl-2-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentylamino]pyrimidin-4-one.
| Compound Name | 3-methyl-6-pyridin-4-yl-2-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentylamino]pyrimidin-4-one |
|---|---|
| PubChem CID | 154632939 |
| Molecular Formula | C28H32N6O |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 3-methyl-6-pyridin-4-yl-2-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentylamino]pyrimidin-4-one |
| SMILES | Cn1c(NCCCCCNc2c3c(nc4ccccc24)CCCC3)nc(-c2ccncc2)cc1=O |
| InChI | InChI=1S/C28H32N6O/c1-34-26(35)19-25(20-13-17-29-18-14-20)33-28(34)31-16-8-2-7-15-30-27-21-9-3-5-11-23(21)32-24-12-6-4-10-22(24)27/h3,5,9,11,13-14,17-19H,2,4,6-8,10,12,15-16H2,1H3,(H,30,32)(H,31,33) |
| InChIKey | OSEIKBVJPXJTSB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|