C20H21FN4O3S — CID 154633549
N-cyclopropyl-N-[4-[4-(3-fluoropropylsulfonylamino)phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide (PubChem CID 154633549) has the molecular formula C20H21FN4O3S and a molecular weight of 416.48 g/mol. Its IUPAC name is N-cyclopropyl-N-[4-[4-(3-fluoropropylsulfonylamino)phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide.
| Compound Name | N-cyclopropyl-N-[4-[4-(3-fluoropropylsulfonylamino)phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide |
|---|---|
| PubChem CID | 154633549 |
| Molecular Formula | C20H21FN4O3S |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-cyclopropyl-N-[4-[4-(3-fluoropropylsulfonylamino)phenyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]formamide |
| SMILES | O=CN(c1cc(-c2ccc(NS(=O)(=O)CCCF)cc2)c2cc[nH]c2n1)C1CC1 |
| InChI | InChI=1S/C20H21FN4O3S/c21-9-1-11-29(27,28)24-15-4-2-14(3-5-15)18-12-19(25(13-26)16-6-7-16)23-20-17(18)8-10-22-20/h2-5,8,10,12-13,16,24H,1,6-7,9,11H2,(H,22,23) |
| InChIKey | MZSQTKGOBCEBOF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|