C21H19F3N4O2 — CID 154633765
2-[4-[6-[cyclopropyl(formyl)amino]-1H-pyrrolo[2,3-b]pyridin-4-yl]phenyl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 154633765) has the molecular formula C21H19F3N4O2 and a molecular weight of 416.40 g/mol. Its IUPAC name is 2-[4-[6-[cyclopropyl(formyl)amino]-1H-pyrrolo[2,3-b]pyridin-4-yl]phenyl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[4-[6-[cyclopropyl(formyl)amino]-1H-pyrrolo[2,3-b]pyridin-4-yl]phenyl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 154633765 |
| Molecular Formula | C21H19F3N4O2 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 2-[4-[6-[cyclopropyl(formyl)amino]-1H-pyrrolo[2,3-b]pyridin-4-yl]phenyl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=CN(c1cc(-c2ccc(CC(=O)NCC(F)(F)F)cc2)c2cc[nH]c2n1)C1CC1 |
| InChI | InChI=1S/C21H19F3N4O2/c22-21(23,24)11-26-19(30)9-13-1-3-14(4-2-13)17-10-18(28(12-29)15-5-6-15)27-20-16(17)7-8-25-20/h1-4,7-8,10,12,15H,5-6,9,11H2,(H,25,27)(H,26,30) |
| InChIKey | UBMJOHKAVHKOQD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|