C26H36N2O3S — CID 15463387
(2R)-4-cyclohexyl-1-[(1S)-1-[4-(4-methoxyphenyl)sulfonylphenyl]ethyl]-2-methylpiperazine (PubChem CID 15463387) has the molecular formula C26H36N2O3S and a molecular weight of 456.65 g/mol. Its IUPAC name is (2R)-4-cyclohexyl-1-[(1S)-1-[4-(4-methoxyphenyl)sulfonylphenyl]ethyl]-2-methylpiperazine.
| Compound Name | (2R)-4-cyclohexyl-1-[(1S)-1-[4-(4-methoxyphenyl)sulfonylphenyl]ethyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 15463387 |
| Molecular Formula | C26H36N2O3S |
| Molecular Weight | 456.65 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | (2R)-4-cyclohexyl-1-[(1S)-1-[4-(4-methoxyphenyl)sulfonylphenyl]ethyl]-2-methylpiperazine |
| SMILES | COc1ccc(S(=O)(=O)c2ccc([C@H](C)N3CCN(C4CCCCC4)C[C@H]3C)cc2)cc1 |
| InChI | InChI=1S/C26H36N2O3S/c1-20-19-27(23-7-5-4-6-8-23)17-18-28(20)21(2)22-9-13-25(14-10-22)32(29,30)26-15-11-24(31-3)12-16-26/h9-16,20-21,23H,4-8,17-19H2,1-3H3/t20-,21+/m1/s1 |
| InChIKey | DZFNPOZRQHNAAX-RTWAWAEBSA-N |
| XLogP | 4.93 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.65 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |