About 4-ethyliminoheptan-2-one
4-ethyliminoheptan-2-one (PubChem CID 154634072) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is 4-ethyliminoheptan-2-one.
Molecular Properties
| Compound Name | 4-ethyliminoheptan-2-one |
| PubChem CID | 154634072 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 4-ethyliminoheptan-2-one |
| SMILES | CCC/C(CC(C)=O)=N\CC |
| InChI | InChI=1S/C9H17NO/c1-4-6-9(10-5-2)7-8(3)11/h4-7H2,1-3H3/b10-9+ |
| InChIKey | QCCKZBSYOBONMM-MDZDMXLPSA-N |
| XLogP | 2.23 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyliminoheptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyliminoheptan-2-one?
The IUPAC name of 4-ethyliminoheptan-2-one (CID 154634072) is 4-ethyliminoheptan-2-one.
What is the SMILES notation for 4-ethyliminoheptan-2-one?
The canonical SMILES for 4-ethyliminoheptan-2-one is CCC/C(CC(C)=O)=N\CC.
What is the InChIKey of 4-ethyliminoheptan-2-one?
The InChIKey is QCCKZBSYOBONMM-MDZDMXLPSA-N. The full InChI is InChI=1S/C9H17NO/c1-4-6-9(10-5-2)7-8(3)11/h4-7H2,1-3H3/b10-9+.
What are the key properties of 4-ethyliminoheptan-2-one?
4-ethyliminoheptan-2-one has a molecular weight of 155.24 g/mol, XLogP of 2.23, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyliminoheptan-2-one is sourced from PubChem (CID 154634072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).