About 4-[2,6-di(propan-2-yl)phenoxy]-7-[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine
4-[2,6-di(propan-2-yl)phenoxy]-7-[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine (PubChem CID 154634200) has the molecular formula C25H23F3N2OS
and a molecular weight of 456.53 g/mol. Its IUPAC name is 4-[2,6-di(propan-2-yl)phenoxy]-7-[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine.
Molecular Properties
| Compound Name | 4-[2,6-di(propan-2-yl)phenoxy]-7-[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine |
| PubChem CID | 154634200 |
| Molecular Formula | C25H23F3N2OS |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 4-[2,6-di(propan-2-yl)phenoxy]-7-[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine |
| SMILES | CC(C)c1cccc(C(C)C)c1Oc1nnc(-c2cccc(C(F)(F)F)c2)c2sccc12 |
| InChI | InChI=1S/C25H23F3N2OS/c1-14(2)18-9-6-10-19(15(3)4)22(18)31-24-20-11-12-32-23(20)21(29-30-24)16-7-5-8-17(13-16)25(26,27)28/h5-15H,1-4H3 |
| InChIKey | FWHRFPLOTNRMQY-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2,6-di(propan-2-yl)phenoxy]-7-[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,6-di(propan-2-yl)phenoxy]-7-[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine?
The IUPAC name of 4-[2,6-di(propan-2-yl)phenoxy]-7-[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine (CID 154634200) is 4-[2,6-di(propan-2-yl)phenoxy]-7-[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine.
What is the SMILES notation for 4-[2,6-di(propan-2-yl)phenoxy]-7-[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine?
The canonical SMILES for 4-[2,6-di(propan-2-yl)phenoxy]-7-[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine is CC(C)c1cccc(C(C)C)c1Oc1nnc(-c2cccc(C(F)(F)F)c2)c2sccc12.
What is the InChIKey of 4-[2,6-di(propan-2-yl)phenoxy]-7-[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine?
The InChIKey is FWHRFPLOTNRMQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23F3N2OS/c1-14(2)18-9-6-10-19(15(3)4)22(18)31-24-20-11-12-32-23(20)21(29-30-24)16-7-5-8-17(13-16)25(26,27)28/h5-15H,1-4H3.
What are the key properties of 4-[2,6-di(propan-2-yl)phenoxy]-7-[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine?
4-[2,6-di(propan-2-yl)phenoxy]-7-[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine has a molecular weight of 456.53 g/mol, XLogP of 8.42, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,6-di(propan-2-yl)phenoxy]-7-[3-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazine is sourced from PubChem (CID 154634200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).